C8H13N5O3S — CID 167856354
2-[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylguanidine (PubChem CID 167856354) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylguanidine.
| Compound Name | 2-[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylguanidine |
|---|---|
| PubChem CID | 167856354 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1cnn(C2CCOC2)c1 |
| InChI | InChI=1S/C8H13N5O3S/c9-8(10)12-17(14,15)7-3-11-13(4-7)6-1-2-16-5-6/h3-4,6H,1-2,5H2,(H4,9,10,12) |
| InChIKey | XQCVKGOULYWJRT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|