C14H21N3O5S — CID 167795752
2-cyclobutyl-2-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]propanoic acid (PubChem CID 167795752) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-cyclobutyl-2-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]propanoic acid.
| Compound Name | 2-cyclobutyl-2-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 167795752 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-cyclobutyl-2-[[1-(oxolan-3-yl)pyrazol-4-yl]sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1cnn(C2CCOC2)c1)(C(=O)O)C1CCC1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(13(18)19,10-3-2-4-10)16-23(20,21)12-7-15-17(8-12)11-5-6-22-9-11/h7-8,10-11,16H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | GRPVEBWVYJFCFD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |