C18H25FN2O3 — CID 167858885
[4-(2-fluoro-3-methoxyphenyl)piperidin-1-yl]-(4-methylmorpholin-2-yl)methanone (PubChem CID 167858885) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is [4-(2-fluoro-3-methoxyphenyl)piperidin-1-yl]-(4-methylmorpholin-2-yl)methanone.
| Compound Name | [4-(2-fluoro-3-methoxyphenyl)piperidin-1-yl]-(4-methylmorpholin-2-yl)methanone |
|---|---|
| PubChem CID | 167858885 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [4-(2-fluoro-3-methoxyphenyl)piperidin-1-yl]-(4-methylmorpholin-2-yl)methanone |
| SMILES | COc1cccc(C2CCN(C(=O)C3CN(C)CCO3)CC2)c1F |
| InChI | InChI=1S/C18H25FN2O3/c1-20-10-11-24-16(12-20)18(22)21-8-6-13(7-9-21)14-4-3-5-15(23-2)17(14)19/h3-5,13,16H,6-12H2,1-2H3 |
| InChIKey | ZXGDSWKYGSOUOW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |