C23H27N3O3S — CID 167859315
2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-3-methyl-1-morpholin-4-ylbutan-1-one (PubChem CID 167859315) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-3-methyl-1-morpholin-4-ylbutan-1-one.
| Compound Name | 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-3-methyl-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 167859315 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)benzimidazol-2-yl]sulfanyl-3-methyl-1-morpholin-4-ylbutan-1-one |
| SMILES | COc1ccc(-n2c(SC(C(=O)N3CCOCC3)C(C)C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-16(2)21(22(27)25-12-14-29-15-13-25)30-23-24-19-6-4-5-7-20(19)26(23)17-8-10-18(28-3)11-9-17/h4-11,16,21H,12-15H2,1-3H3 |
| InChIKey | WQWDNINVSHIJGS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |