C12H16N4O — CID 167859865
(E)-1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1H-pyrazol-4-yl)prop-2-en-1-one (PubChem CID 167859865) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (E)-1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1H-pyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1H-pyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167859865 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (E)-1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(1H-pyrazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn[nH]c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C12H16N4O/c17-12(2-1-9-3-14-15-4-9)16-7-10-5-13-6-11(10)8-16/h1-4,10-11,13H,5-8H2,(H,14,15)/b2-1+/t10-,11+ |
| InChIKey | BXWYGZHKFPOFKY-SHLGALIJSA-N |
| XLogP | 0.10 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|