C14H12N6 — CID 167860301
3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]propanenitrile (PubChem CID 167860301) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]propanenitrile.
| Compound Name | 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 167860301 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]propanenitrile |
| SMILES | N#CCCNc1cc(-c2ccccc2)nc2ncnn12 |
| InChI | InChI=1S/C14H12N6/c15-7-4-8-16-13-9-12(11-5-2-1-3-6-11)19-14-17-10-18-20(13)14/h1-3,5-6,9-10,16H,4,8H2 |
| InChIKey | YENUJYLRFDCJSC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|