C19H17N7O — CID 60505945
N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]pyridine-3-carboxamide (PubChem CID 60505945) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60505945 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNc1cc(-c2ccccc2)nc2ncnn12)c1cccnc1 |
| InChI | InChI=1S/C19H17N7O/c27-18(15-7-4-8-20-12-15)22-10-9-21-17-11-16(14-5-2-1-3-6-14)25-19-23-13-24-26(17)19/h1-8,11-13,21H,9-10H2,(H,22,27) |
| InChIKey | HJIYKJMQGQXVTG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|