C20H19N7O3 — CID 86974971
N-[3-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 86974971) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[3-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86974971 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(NCCNC(=O)c2cccc(NC(=O)c3ccco3)c2)n2ncnc2n1 |
| InChI | InChI=1S/C20H19N7O3/c1-13-10-17(27-20(25-13)23-12-24-27)21-7-8-22-18(28)14-4-2-5-15(11-14)26-19(29)16-6-3-9-30-16/h2-6,9-12,21H,7-8H2,1H3,(H,22,28)(H,26,29) |
| InChIKey | HLNAFEJEUJBWIK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|