C21H20N6O2 — CID 78845185
3-methoxy-N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]benzamide (PubChem CID 78845185) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78845185 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-methoxy-N-[2-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCNc2cc(-c3ccccc3)nc3ncnn23)c1 |
| InChI | InChI=1S/C21H20N6O2/c1-29-17-9-5-8-16(12-17)20(28)23-11-10-22-19-13-18(15-6-3-2-4-7-15)26-21-24-14-25-27(19)21/h2-9,12-14,22H,10-11H2,1H3,(H,23,28) |
| InChIKey | YSKZWTNPRWOQEH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|