C11H18BrN7O — CID 167861007
2-[2-(3-oxopiperazin-1-yl)ethyl]-1-pyrimidin-2-ylguanidine;hydrobromide (PubChem CID 167861007) has the molecular formula C11H18BrN7O and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-[2-(3-oxopiperazin-1-yl)ethyl]-1-pyrimidin-2-ylguanidine;hydrobromide.
| Compound Name | 2-[2-(3-oxopiperazin-1-yl)ethyl]-1-pyrimidin-2-ylguanidine;hydrobromide |
|---|---|
| PubChem CID | 167861007 |
| Molecular Formula | C11H18BrN7O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[2-(3-oxopiperazin-1-yl)ethyl]-1-pyrimidin-2-ylguanidine;hydrobromide |
| SMILES | Br.N/C(=N\CCN1CCNC(=O)C1)Nc1ncccn1 |
| InChI | InChI=1S/C11H17N7O.BrH/c12-10(17-11-15-2-1-3-16-11)14-5-7-18-6-4-13-9(19)8-18;/h1-3H,4-8H2,(H,13,19)(H3,12,14,15,16,17);1H |
| InChIKey | VITGGJWQQLSTOE-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|