C18H30N2O — CID 16786128
1-(4-tert-butylphenyl)-2-(2,6-dimethylmorpholin-4-yl)ethanamine (PubChem CID 16786128) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(2,6-dimethylmorpholin-4-yl)ethanamine.
| Compound Name | 1-(4-tert-butylphenyl)-2-(2,6-dimethylmorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 16786128 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(2,6-dimethylmorpholin-4-yl)ethanamine |
| SMILES | CC1CN(CC(N)c2ccc(C(C)(C)C)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H30N2O/c1-13-10-20(11-14(2)21-13)12-17(19)15-6-8-16(9-7-15)18(3,4)5/h6-9,13-14,17H,10-12,19H2,1-5H3 |
| InChIKey | PRSBWDLYXIYCOC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |