C14H17ClFNO2S — CID 167862488
2-(2-chloro-4-fluorophenyl)-2-[3-(methylsulfanylmethyl)pyrrolidin-1-yl]acetic acid (PubChem CID 167862488) has the molecular formula C14H17ClFNO2S and a molecular weight of 317.81 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-2-[3-(methylsulfanylmethyl)pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-2-[3-(methylsulfanylmethyl)pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 167862488 |
| Molecular Formula | C14H17ClFNO2S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-2-[3-(methylsulfanylmethyl)pyrrolidin-1-yl]acetic acid |
| SMILES | CSCC1CCN(C(C(=O)O)c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H17ClFNO2S/c1-20-8-9-4-5-17(7-9)13(14(18)19)11-3-2-10(16)6-12(11)15/h2-3,6,9,13H,4-5,7-8H2,1H3,(H,18,19) |
| InChIKey | HEAHCJJHPPRKHU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |