About 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate
1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate (PubChem CID 167862962) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate.
Molecular Properties
| Compound Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate |
| PubChem CID | 167862962 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate |
| SMILES | Cc1nc(C(C)OC(=O)c2ccccc2)no1 |
| InChI | InChI=1S/C12H12N2O3/c1-8(11-13-9(2)17-14-11)16-12(15)10-6-4-3-5-7-10/h3-8H,1-2H3 |
| InChIKey | VLABVCXHPMDQJX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate?
The IUPAC name of 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate (CID 167862962) is 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate.
What is the SMILES notation for 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate?
The canonical SMILES for 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate is Cc1nc(C(C)OC(=O)c2ccccc2)no1.
What is the InChIKey of 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate?
The InChIKey is VLABVCXHPMDQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8(11-13-9(2)17-14-11)16-12(15)10-6-4-3-5-7-10/h3-8H,1-2H3.
What are the key properties of 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate?
1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate has a molecular weight of 232.24 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl benzoate is sourced from PubChem (CID 167862962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).