About 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone
2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone (PubChem CID 167865582) has the molecular formula C14H17N5O
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone |
| PubChem CID | 167865582 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone |
| SMILES | O=C(c1cccc2n[nH]nc12)N1CCC2(CCN2)CC1 |
| InChI | InChI=1S/C14H17N5O/c20-13(10-2-1-3-11-12(10)17-18-16-11)19-8-5-14(6-9-19)4-7-15-14/h1-3,15H,4-9H2,(H,16,17,18) |
| InChIKey | BAVTZDGHXGEJLZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The IUPAC name of 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone (CID 167865582) is 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone.
What is the SMILES notation for 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The canonical SMILES for 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone is O=C(c1cccc2n[nH]nc12)N1CCC2(CCN2)CC1.
What is the InChIKey of 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The InChIKey is BAVTZDGHXGEJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O/c20-13(10-2-1-3-11-12(10)17-18-16-11)19-8-5-14(6-9-19)4-7-15-14/h1-3,15H,4-9H2,(H,16,17,18).
What are the key properties of 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone has a molecular weight of 271.32 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-yl(1,7-diazaspiro[3.5]nonan-7-yl)methanone is sourced from PubChem (CID 167865582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).