C18H25N5O — CID 119034600
[3-(azepan-1-yl)piperidin-1-yl]-(2H-benzotriazol-4-yl)methanone (PubChem CID 119034600) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is [3-(azepan-1-yl)piperidin-1-yl]-(2H-benzotriazol-4-yl)methanone.
| Compound Name | [3-(azepan-1-yl)piperidin-1-yl]-(2H-benzotriazol-4-yl)methanone |
|---|---|
| PubChem CID | 119034600 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | [3-(azepan-1-yl)piperidin-1-yl]-(2H-benzotriazol-4-yl)methanone |
| SMILES | O=C(c1cccc2n[nH]nc12)N1CCCC(N2CCCCCC2)C1 |
| InChI | InChI=1S/C18H25N5O/c24-18(15-8-5-9-16-17(15)20-21-19-16)23-12-6-7-14(13-23)22-10-3-1-2-4-11-22/h5,8-9,14H,1-4,6-7,10-13H2,(H,19,20,21) |
| InChIKey | CBMREAUSVKASIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |