C24H26F3N3O2S — CID 167866234
N-[3-(thiomorpholin-4-ylmethyl)phenyl]-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 167866234) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[3-(thiomorpholin-4-ylmethyl)phenyl]-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-(thiomorpholin-4-ylmethyl)phenyl]-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167866234 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[3-(thiomorpholin-4-ylmethyl)phenyl]-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc(CN2CCSCC2)cc(NC2Cc3[nH]c4ccccc4c3C2)c1 |
| InChI | InChI=1S/C22H25N3S.C2HF3O2/c1-2-7-21-19(6-1)20-13-18(14-22(20)24-21)23-17-5-3-4-16(12-17)15-25-8-10-26-11-9-25;3-2(4,5)1(6)7/h1-7,12,18,23-24H,8-11,13-15H2;(H,6,7) |
| InChIKey | VQSMRJYHSQWAHN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|