About [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol
[3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol (PubChem CID 167867440) has the molecular formula C19H22N4O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol |
| PubChem CID | 167867440 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol |
| SMILES | COc1nc(C)cc(C)c1Cn1cc(COc2cccc(CO)c2)nn1 |
| InChI | InChI=1S/C19H22N4O3/c1-13-7-14(2)20-19(25-3)18(13)10-23-9-16(21-22-23)12-26-17-6-4-5-15(8-17)11-24/h4-9,24H,10-12H2,1-3H3 |
| InChIKey | MWHCOHJLYFWDGK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol?
The IUPAC name of [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol (CID 167867440) is [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol.
What is the SMILES notation for [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol?
The canonical SMILES for [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol is COc1nc(C)cc(C)c1Cn1cc(COc2cccc(CO)c2)nn1.
What is the InChIKey of [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol?
The InChIKey is MWHCOHJLYFWDGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O3/c1-13-7-14(2)20-19(25-3)18(13)10-23-9-16(21-22-23)12-26-17-6-4-5-15(8-17)11-24/h4-9,24H,10-12H2,1-3H3.
What are the key properties of [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol?
[3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol has a molecular weight of 354.41 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[1-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]triazol-4-yl]methoxy]phenyl]methanol is sourced from PubChem (CID 167867440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).