C19H15F3N4O3 — CID 167867876
3-[(1-pyridin-3-ylpyrazole-3-carbonyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 167867876) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is 3-[(1-pyridin-3-ylpyrazole-3-carbonyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[(1-pyridin-3-ylpyrazole-3-carbonyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 167867876 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-[(1-pyridin-3-ylpyrazole-3-carbonyl)amino]-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccn(-c2cccnc2)n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N4O3/c20-19(21,22)13-5-3-12(4-6-13)16(10-17(27)28)24-18(29)15-7-9-26(25-15)14-2-1-8-23-11-14/h1-9,11,16H,10H2,(H,24,29)(H,27,28) |
| InChIKey | OWQJLEWFFYFWQZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |