C14H19N5O — CID 167868735
1-(2,4-dimethylphenyl)-3-(1-propan-2-yltriazol-4-yl)urea (PubChem CID 167868735) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(1-propan-2-yltriazol-4-yl)urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(1-propan-2-yltriazol-4-yl)urea |
|---|---|
| PubChem CID | 167868735 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(1-propan-2-yltriazol-4-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cn(C(C)C)nn2)c(C)c1 |
| InChI | InChI=1S/C14H19N5O/c1-9(2)19-8-13(17-18-19)16-14(20)15-12-6-5-10(3)7-11(12)4/h5-9H,1-4H3,(H2,15,16,20) |
| InChIKey | RWAOOUZMFYIIHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |