C12H10F3N3O4 — CID 167869861
2-hydroxy-3-[[3-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]propanoic acid (PubChem CID 167869861) has the molecular formula C12H10F3N3O4 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-hydroxy-3-[[3-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-3-[[3-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167869861 |
| Molecular Formula | C12H10F3N3O4 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-hydroxy-3-[[3-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]propanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1cccc(C2(C(F)(F)F)N=N2)c1 |
| InChI | InChI=1S/C12H10F3N3O4/c13-12(14,15)11(17-18-11)7-3-1-2-6(4-7)9(20)16-5-8(19)10(21)22/h1-4,8,19H,5H2,(H,16,20)(H,21,22) |
| InChIKey | PHQBSWDOMOYELN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |