C19H18N2O3 — CID 167873169
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide (PubChem CID 167873169) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide.
| Compound Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide |
|---|---|
| PubChem CID | 167873169 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide |
| SMILES | O=C(NO)c1ccc(CNC(=O)C2C3Cc4ccccc4C32)cc1 |
| InChI | InChI=1S/C19H18N2O3/c22-18(21-24)12-7-5-11(6-8-12)10-20-19(23)17-15-9-13-3-1-2-4-14(13)16(15)17/h1-8,15-17,24H,9-10H2,(H,20,23)(H,21,22) |
| InChIKey | KBZMGBIXMHSVRT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|