C23H25N3O4 — CID 167874136
2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[[1-(2-prop-2-ynylpent-4-ynoyl)-2,5-dihydropyrrol-2-yl]methyl]acetamide (PubChem CID 167874136) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[[1-(2-prop-2-ynylpent-4-ynoyl)-2,5-dihydropyrrol-2-yl]methyl]acetamide.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[[1-(2-prop-2-ynylpent-4-ynoyl)-2,5-dihydropyrrol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 167874136 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[[1-(2-prop-2-ynylpent-4-ynoyl)-2,5-dihydropyrrol-2-yl]methyl]acetamide |
| SMILES | C#CCC(CC#C)C(=O)N1CC=CC1CNC(=O)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C23H25N3O4/c1-3-8-16(9-4-2)21(28)25-13-7-10-17(25)14-24-20(27)15-26-22(29)18-11-5-6-12-19(18)23(26)30/h1-2,5-7,10,16-19H,8-9,11-15H2,(H,24,27)/t17?,18-,19+ |
| InChIKey | YEULDYZXHGZDBG-YQQQUEKLSA-N |
| XLogP | 0.48 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|