C15H15NO4 — CID 167878798
3-[4-(3-hydroxypyrrolidin-1-yl)phenyl]furan-2-carboxylic acid (PubChem CID 167878798) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[4-(3-hydroxypyrrolidin-1-yl)phenyl]furan-2-carboxylic acid.
| Compound Name | 3-[4-(3-hydroxypyrrolidin-1-yl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 167878798 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[4-(3-hydroxypyrrolidin-1-yl)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1-c1ccc(N2CCC(O)C2)cc1 |
| InChI | InChI=1S/C15H15NO4/c17-12-5-7-16(9-12)11-3-1-10(2-4-11)13-6-8-20-14(13)15(18)19/h1-4,6,8,12,17H,5,7,9H2,(H,18,19) |
| InChIKey | KGGHBTKQPOCETA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |