C22H23NO5 — CID 167881116
3-(1-methoxycyclobutyl)-2-[(3-methylbenzo[g][1]benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 167881116) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(1-methoxycyclobutyl)-2-[(3-methylbenzo[g][1]benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-(1-methoxycyclobutyl)-2-[(3-methylbenzo[g][1]benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167881116 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(1-methoxycyclobutyl)-2-[(3-methylbenzo[g][1]benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | COC1(CC(NC(=O)c2oc3c(ccc4ccccc43)c2C)C(=O)O)CCC1 |
| InChI | InChI=1S/C22H23NO5/c1-13-15-9-8-14-6-3-4-7-16(14)19(15)28-18(13)20(24)23-17(21(25)26)12-22(27-2)10-5-11-22/h3-4,6-9,17H,5,10-12H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | OUXCMVYYNXRVRV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |