C22H19N3O3S — CID 167881872
N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide (PubChem CID 167881872) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide.
| Compound Name | N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 167881872 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-oxo-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C(=O)c3ccc4c(c3)CCC(=O)N4)n2)c(C)c1 |
| InChI | InChI=1S/C22H19N3O3S/c1-12-3-6-16(13(2)9-12)18-11-29-22(24-18)25-21(28)20(27)15-4-7-17-14(10-15)5-8-19(26)23-17/h3-4,6-7,9-11H,5,8H2,1-2H3,(H,23,26)(H,24,25,28) |
| InChIKey | IOSYNNQUKBWQJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|