C16H28N4O2 — CID 167882816
2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-methylamino]-1-morpholin-4-ylethanone (PubChem CID 167882816) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-methylamino]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-methylamino]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 167882816 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl-methylamino]-1-morpholin-4-ylethanone |
| SMILES | CN(CC(=O)N1CCOCC1)Cc1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C16H28N4O2/c1-16(2,3)15-13(11-19(5)17-15)10-18(4)12-14(21)20-6-8-22-9-7-20/h11H,6-10,12H2,1-5H3 |
| InChIKey | VPJZNGFIFIHJOQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |