C16H19N3O4 — CID 167883244
(3R)-1-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 167883244) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is (3R)-1-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167883244 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (3R)-1-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(/C=C/C(=O)N1CCC[C@@H](C(=O)O)C1)NCc1cccnc1 |
| InChI | InChI=1S/C16H19N3O4/c20-14(18-10-12-3-1-7-17-9-12)5-6-15(21)19-8-2-4-13(11-19)16(22)23/h1,3,5-7,9,13H,2,4,8,10-11H2,(H,18,20)(H,22,23)/b6-5+/t13-/m1/s1 |
| InChIKey | YPVMPVATDBTXRU-URWSZGRFSA-N |
| XLogP | 0.58 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|