C15H17N3O4 — CID 167977999
2-[cyclopropyl-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]amino]acetic acid (PubChem CID 167977999) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[cyclopropyl-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 167977999 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[cyclopropyl-[(E)-4-oxo-4-(pyridin-3-ylmethylamino)but-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)/C=C/C(=O)NCc1cccnc1)C1CC1 |
| InChI | InChI=1S/C15H17N3O4/c19-13(17-9-11-2-1-7-16-8-11)5-6-14(20)18(10-15(21)22)12-3-4-12/h1-2,5-8,12H,3-4,9-10H2,(H,17,19)(H,21,22)/b6-5+ |
| InChIKey | OMSCSLIATFVCGC-AATRIKPKSA-N |
| XLogP | 0.33 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|