C17H28N4O2 — CID 167885406
tert-butyl N-[8-(1H-pyrazol-5-ylmethylamino)-3-bicyclo[3.2.1]octanyl]carbamate (PubChem CID 167885406) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-[8-(1H-pyrazol-5-ylmethylamino)-3-bicyclo[3.2.1]octanyl]carbamate.
| Compound Name | tert-butyl N-[8-(1H-pyrazol-5-ylmethylamino)-3-bicyclo[3.2.1]octanyl]carbamate |
|---|---|
| PubChem CID | 167885406 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl N-[8-(1H-pyrazol-5-ylmethylamino)-3-bicyclo[3.2.1]octanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC2CCC(C1)C2NCc1ccn[nH]1 |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,3)23-16(22)20-14-8-11-4-5-12(9-14)15(11)18-10-13-6-7-19-21-13/h6-7,11-12,14-15,18H,4-5,8-10H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | RXAVPNQQDVJDOO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |