C9H11ClFN3O2S — CID 167885837
N-[[2-(acetamidomethyl)-1,3-thiazol-4-yl]methyl]-2-chloro-2-fluoroacetamide (PubChem CID 167885837) has the molecular formula C9H11ClFN3O2S and a molecular weight of 279.72 g/mol. Its IUPAC name is N-[[2-(acetamidomethyl)-1,3-thiazol-4-yl]methyl]-2-chloro-2-fluoroacetamide.
| Compound Name | N-[[2-(acetamidomethyl)-1,3-thiazol-4-yl]methyl]-2-chloro-2-fluoroacetamide |
|---|---|
| PubChem CID | 167885837 |
| Molecular Formula | C9H11ClFN3O2S |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-[[2-(acetamidomethyl)-1,3-thiazol-4-yl]methyl]-2-chloro-2-fluoroacetamide |
| SMILES | CC(=O)NCc1nc(CNC(=O)C(F)Cl)cs1 |
| InChI | InChI=1S/C9H11ClFN3O2S/c1-5(15)12-3-7-14-6(4-17-7)2-13-9(16)8(10)11/h4,8H,2-3H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | QKAPOTVHLRBTBT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|