C15H15N3O3 — CID 167888307
3-[(3-hydroxy-3-phenylcyclobutyl)amino]pyrazine-2-carboxylic acid (PubChem CID 167888307) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[(3-hydroxy-3-phenylcyclobutyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[(3-hydroxy-3-phenylcyclobutyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167888307 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[(3-hydroxy-3-phenylcyclobutyl)amino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NC1CC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C15H15N3O3/c19-14(20)12-13(17-7-6-16-12)18-11-8-15(21,9-11)10-4-2-1-3-5-10/h1-7,11,21H,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | HPLJTINKONFSAB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |