3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid

C10H13N3O2 — CID 62710998

IUPAC3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid
SMILESCC1(C)CC1Nc1nccnc1C(=O)O
InChIInChI=1S/C10H13N3O2/c1-10(2)5-6(10)13-8-7(9(14)15)11-3-4-12-8/h3-4,6H,5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeySKNSPDOUULGLQM-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.39
Rot. Bonds3

About 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid

3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid (PubChem CID 62710998) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid
PubChem CID62710998
Molecular FormulaC10H13N3O2
Molecular Weight207.23 g/mol
Exact Mass207.10
IUPAC Name3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid
SMILESCC1(C)CC1Nc1nccnc1C(=O)O
InChIInChI=1S/C10H13N3O2/c1-10(2)5-6(10)13-8-7(9(14)15)11-3-4-12-8/h3-4,6H,5H2,1-2H3,(H,12,13)(H,14,15)
InChIKeySKNSPDOUULGLQM-UHFFFAOYSA-N
XLogP1.39
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid?
The IUPAC name of 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid (CID 62710998) is 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid?
The canonical SMILES for 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid is CC1(C)CC1Nc1nccnc1C(=O)O.
What is the InChIKey of 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid?
The InChIKey is SKNSPDOUULGLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-10(2)5-6(10)13-8-7(9(14)15)11-3-4-12-8/h3-4,6H,5H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid?
3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethylcyclopropyl)amino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 62710998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).