C18H23NO — CID 167890511
N-[cyclopentyl(phenyl)methyl]spiro[2.2]pentane-2-carboxamide (PubChem CID 167890511) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[cyclopentyl(phenyl)methyl]spiro[2.2]pentane-2-carboxamide.
| Compound Name | N-[cyclopentyl(phenyl)methyl]spiro[2.2]pentane-2-carboxamide |
|---|---|
| PubChem CID | 167890511 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[cyclopentyl(phenyl)methyl]spiro[2.2]pentane-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C1CCCC1)C1CC12CC2 |
| InChI | InChI=1S/C18H23NO/c20-17(15-12-18(15)10-11-18)19-16(14-8-4-5-9-14)13-6-2-1-3-7-13/h1-3,6-7,14-16H,4-5,8-12H2,(H,19,20) |
| InChIKey | QROSJKLZXPZOHI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |