C14H18N2O4S — CID 167891536
2-(1,3-dihydroisoindol-2-ylsulfonylamino)-4-methylpent-4-enoic acid (PubChem CID 167891536) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-ylsulfonylamino)-4-methylpent-4-enoic acid.
| Compound Name | 2-(1,3-dihydroisoindol-2-ylsulfonylamino)-4-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 167891536 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-ylsulfonylamino)-4-methylpent-4-enoic acid |
| SMILES | C=C(C)CC(NS(=O)(=O)N1Cc2ccccc2C1)C(=O)O |
| InChI | InChI=1S/C14H18N2O4S/c1-10(2)7-13(14(17)18)15-21(19,20)16-8-11-5-3-4-6-12(11)9-16/h3-6,13,15H,1,7-9H2,2H3,(H,17,18) |
| InChIKey | ONKITUPCWQHWTR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|