C11H16N6 — CID 167893366
4-ethyl-N-[(1-prop-2-enylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine (PubChem CID 167893366) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-ethyl-N-[(1-prop-2-enylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-ethyl-N-[(1-prop-2-enylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167893366 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 4-ethyl-N-[(1-prop-2-enylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine |
| SMILES | C=CCn1cc(CNc2nncn2CC)cn1 |
| InChI | InChI=1S/C11H16N6/c1-3-5-17-8-10(7-14-17)6-12-11-15-13-9-16(11)4-2/h3,7-9H,1,4-6H2,2H3,(H,12,15) |
| InChIKey | FVQUZFDBFZKQSM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|