C12H15BrN6O — CID 106303387
4-bromo-5-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-2-prop-2-enylpyridazin-3-one (PubChem CID 106303387) has the molecular formula C12H15BrN6O and a molecular weight of 339.20 g/mol. Its IUPAC name is 4-bromo-5-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 106303387 |
| Molecular Formula | C12H15BrN6O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-bromo-5-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCc2nncn2CC)c(Br)c1=O |
| InChI | InChI=1S/C12H15BrN6O/c1-3-5-19-12(20)11(13)9(6-16-19)14-7-10-17-15-8-18(10)4-2/h3,6,8,14H,1,4-5,7H2,2H3 |
| InChIKey | ITDXBKPCMMOSNR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|