C13H9F4NO3 — CID 167893561
methyl (E)-2-cyano-3-[3-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoate (PubChem CID 167893561) has the molecular formula C13H9F4NO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[3-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[3-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 167893561 |
| Molecular Formula | C13H9F4NO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | methyl (E)-2-cyano-3-[3-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cccc(F)c1OCC(F)(F)F |
| InChI | InChI=1S/C13H9F4NO3/c1-20-12(19)9(6-18)5-8-3-2-4-10(14)11(8)21-7-13(15,16)17/h2-5H,7H2,1H3/b9-5+ |
| InChIKey | LTBRHFKSCGGKTE-WEVVVXLNSA-N |
| XLogP | 2.85 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|