C20H21N5O2 — CID 167894801
N'-[2-(imidazol-1-ylmethyl)phenyl]-N-(4,5,6,7-tetrahydro-1H-indol-4-yl)oxamide (PubChem CID 167894801) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N'-[2-(imidazol-1-ylmethyl)phenyl]-N-(4,5,6,7-tetrahydro-1H-indol-4-yl)oxamide.
| Compound Name | N'-[2-(imidazol-1-ylmethyl)phenyl]-N-(4,5,6,7-tetrahydro-1H-indol-4-yl)oxamide |
|---|---|
| PubChem CID | 167894801 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-[2-(imidazol-1-ylmethyl)phenyl]-N-(4,5,6,7-tetrahydro-1H-indol-4-yl)oxamide |
| SMILES | O=C(Nc1ccccc1Cn1ccnc1)C(=O)NC1CCCc2[nH]ccc21 |
| InChI | InChI=1S/C20H21N5O2/c26-19(20(27)24-18-7-3-6-17-15(18)8-9-22-17)23-16-5-2-1-4-14(16)12-25-11-10-21-13-25/h1-2,4-5,8-11,13,18,22H,3,6-7,12H2,(H,23,26)(H,24,27) |
| InChIKey | LJXOEWANALUEDA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|