C13H15N3O3 — CID 57306427
methoxymethyl N-[2-(imidazol-1-ylmethyl)phenyl]carbamate (PubChem CID 57306427) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methoxymethyl N-[2-(imidazol-1-ylmethyl)phenyl]carbamate.
| Compound Name | methoxymethyl N-[2-(imidazol-1-ylmethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 57306427 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methoxymethyl N-[2-(imidazol-1-ylmethyl)phenyl]carbamate |
| SMILES | COCOC(=O)Nc1ccccc1Cn1ccnc1 |
| InChI | InChI=1S/C13H15N3O3/c1-18-10-19-13(17)15-12-5-3-2-4-11(12)8-16-7-6-14-9-16/h2-7,9H,8,10H2,1H3,(H,15,17) |
| InChIKey | HYICFZHWNSIBHI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|