C22H24N4O — CID 167898904
3-phenyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-1H-pyrazole-5-carboxamide (PubChem CID 167898904) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-phenyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167898904 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-phenyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCCC1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H24N4O/c27-22(20-15-19(24-25-20)17-9-3-1-4-10-17)23-16-21(26-13-7-8-14-26)18-11-5-2-6-12-18/h1-6,9-12,15,21H,7-8,13-14,16H2,(H,23,27)(H,24,25) |
| InChIKey | AGUHTPQVQHRYGB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |