C20H22N4O2 — CID 41037776
N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 41037776) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 41037776 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC[C@H](c1ccco1)N1CCCC1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H22N4O2/c25-20(17-13-16(22-23-17)15-7-2-1-3-8-15)21-14-18(19-9-6-12-26-19)24-10-4-5-11-24/h1-3,6-9,12-13,18H,4-5,10-11,14H2,(H,21,25)(H,22,23)/t18-/m1/s1 |
| InChIKey | ZTYBEDFXWRACFO-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |