C18H27FN2O3S — CID 167899179
4-[2-(2-fluorophenyl)ethylsulfonyl]-N,N-dimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-7-amine (PubChem CID 167899179) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)ethylsulfonyl]-N,N-dimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-7-amine.
| Compound Name | 4-[2-(2-fluorophenyl)ethylsulfonyl]-N,N-dimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 167899179 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[2-(2-fluorophenyl)ethylsulfonyl]-N,N-dimethyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-7-amine |
| SMILES | CN(C)C1CCC2C(C1)OCCN2S(=O)(=O)CCc1ccccc1F |
| InChI | InChI=1S/C18H27FN2O3S/c1-20(2)15-7-8-17-18(13-15)24-11-10-21(17)25(22,23)12-9-14-5-3-4-6-16(14)19/h3-6,15,17-18H,7-13H2,1-2H3 |
| InChIKey | UCWIYFBJOUDHKY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |