C16H18F2N2O4 — CID 167899255
3-[[4-(difluoromethoxy)phenyl]methyl]-6-(oxolan-3-yl)piperazine-2,5-dione (PubChem CID 167899255) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)phenyl]methyl]-6-(oxolan-3-yl)piperazine-2,5-dione.
| Compound Name | 3-[[4-(difluoromethoxy)phenyl]methyl]-6-(oxolan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 167899255 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[[4-(difluoromethoxy)phenyl]methyl]-6-(oxolan-3-yl)piperazine-2,5-dione |
| SMILES | O=C1NC(C2CCOC2)C(=O)NC1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H18F2N2O4/c17-16(18)24-11-3-1-9(2-4-11)7-12-14(21)20-13(15(22)19-12)10-5-6-23-8-10/h1-4,10,12-13,16H,5-8H2,(H,19,22)(H,20,21) |
| InChIKey | LQVTUWJMINRJNV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |