C16H19N5O2S — CID 167901737
1-[4-(2-methylpyrazol-3-yl)-1,3-thiazol-2-yl]-3-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]urea (PubChem CID 167901737) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[4-(2-methylpyrazol-3-yl)-1,3-thiazol-2-yl]-3-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]urea.
| Compound Name | 1-[4-(2-methylpyrazol-3-yl)-1,3-thiazol-2-yl]-3-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]urea |
|---|---|
| PubChem CID | 167901737 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[4-(2-methylpyrazol-3-yl)-1,3-thiazol-2-yl]-3-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]urea |
| SMILES | Cn1nccc1-c1csc(NC(=O)NC[C@@H]2C[C@@H]3O[C@H]2[C@H]2C[C@H]23)n1 |
| InChI | InChI=1S/C16H19N5O2S/c1-21-12(2-3-18-21)11-7-24-16(19-11)20-15(22)17-6-8-4-13-9-5-10(9)14(8)23-13/h2-3,7-10,13-14H,4-6H2,1H3,(H2,17,19,20,22)/t8-,9+,10-,13-,14+/m0/s1 |
| InChIKey | ASYIVUIOYHMSKT-AUWDCVOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |