C17H18N4O3 — CID 167915062
2-methyl-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-4-oxo-3H-pyrido[3,2-d]pyrimidine-6-carboxamide (PubChem CID 167915062) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-methyl-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-4-oxo-3H-pyrido[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | 2-methyl-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-4-oxo-3H-pyrido[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 167915062 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-methyl-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-4-oxo-3H-pyrido[3,2-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NC[C@@H]3C[C@@H]4O[C@H]3[C@H]3C[C@H]34)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N4O3/c1-7-19-11-2-3-12(21-14(11)17(23)20-7)16(22)18-6-8-4-13-9-5-10(9)15(8)24-13/h2-3,8-10,13,15H,4-6H2,1H3,(H,18,22)(H,19,20,23)/t8-,9+,10-,13-,15+/m0/s1 |
| InChIKey | VSFXJPGVCJERGC-SNVNHWNNSA-N |
| XLogP | 0.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |