C11H14N4O2S — CID 154846724
1-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 154846724) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 154846724 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(NC[C@@H]1C[C@@H]2O[C@H]1[C@H]1C[C@H]12)Nc1nncs1 |
| InChI | InChI=1S/C11H14N4O2S/c16-10(14-11-15-13-4-18-11)12-3-5-1-8-6-2-7(6)9(5)17-8/h4-9H,1-3H2,(H2,12,14,15,16)/t5-,6+,7-,8-,9+/m0/s1 |
| InChIKey | BPARQJJKCRKINK-QKAWAISNSA-N |
| XLogP | 1.08 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |