C14H17N3O3S — CID 154847053
N'-(3-methyl-1,2-thiazol-5-yl)-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]oxamide (PubChem CID 154847053) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N'-(3-methyl-1,2-thiazol-5-yl)-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]oxamide.
| Compound Name | N'-(3-methyl-1,2-thiazol-5-yl)-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]oxamide |
|---|---|
| PubChem CID | 154847053 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N'-(3-methyl-1,2-thiazol-5-yl)-N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC[C@@H]2C[C@@H]3O[C@H]2[C@H]2C[C@H]23)sn1 |
| InChI | InChI=1S/C14H17N3O3S/c1-6-2-11(21-17-6)16-14(19)13(18)15-5-7-3-10-8-4-9(8)12(7)20-10/h2,7-10,12H,3-5H2,1H3,(H,15,18)(H,16,19)/t7-,8+,9-,10-,12+/m0/s1 |
| InChIKey | HQAWZEAQXDXFQY-YXZBHFDYSA-N |
| XLogP | 0.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|