C15H18ClFN6 — CID 167903656
(7S,8aS)-2-[[2-chloro-4-(2H-tetrazol-5-yl)phenyl]methyl]-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 167903656) has the molecular formula C15H18ClFN6 and a molecular weight of 336.80 g/mol. Its IUPAC name is (7S,8aS)-2-[[2-chloro-4-(2H-tetrazol-5-yl)phenyl]methyl]-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7S,8aS)-2-[[2-chloro-4-(2H-tetrazol-5-yl)phenyl]methyl]-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 167903656 |
| Molecular Formula | C15H18ClFN6 |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (7S,8aS)-2-[[2-chloro-4-(2H-tetrazol-5-yl)phenyl]methyl]-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | F[C@H]1C[C@H]2CN(Cc3ccc(-c4nn[nH]n4)cc3Cl)CCN2C1 |
| InChI | InChI=1S/C15H18ClFN6/c16-14-5-10(15-18-20-21-19-15)1-2-11(14)7-22-3-4-23-8-12(17)6-13(23)9-22/h1-2,5,12-13H,3-4,6-9H2,(H,18,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | QIZVTRRFPQPXKL-STQMWFEESA-N |
| XLogP | 1.75 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |