C13H15Cl2NO4 — CID 167903946
N-(3,4-dichlorophenyl)-2-hydroxy-2-(4-hydroxyoxan-4-yl)acetamide (PubChem CID 167903946) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-hydroxy-2-(4-hydroxyoxan-4-yl)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-hydroxy-2-(4-hydroxyoxan-4-yl)acetamide |
|---|---|
| PubChem CID | 167903946 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-hydroxy-2-(4-hydroxyoxan-4-yl)acetamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C(O)C1(O)CCOCC1 |
| InChI | InChI=1S/C13H15Cl2NO4/c14-9-2-1-8(7-10(9)15)16-12(18)11(17)13(19)3-5-20-6-4-13/h1-2,7,11,17,19H,3-6H2,(H,16,18) |
| InChIKey | QOCFBFSQYSWZCO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |