C12H12ClF2NO2 — CID 167906269
2-chloro-N-[(1S)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-yl]acetamide (PubChem CID 167906269) has the molecular formula C12H12ClF2NO2 and a molecular weight of 275.68 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-yl]acetamide.
| Compound Name | 2-chloro-N-[(1S)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-yl]acetamide |
|---|---|
| PubChem CID | 167906269 |
| Molecular Formula | C12H12ClF2NO2 |
| Molecular Weight | 275.68 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-N-[(1S)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-yl]acetamide |
| SMILES | O=C(CCl)N[C@H]1CCc2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C12H12ClF2NO2/c13-6-11(17)16-10-4-2-7-1-3-8(5-9(7)10)18-12(14)15/h1,3,5,10,12H,2,4,6H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | VOECVWRBXKBBCR-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|